C15H14BrClO4 — CID 151123239
3-(2-bromo-5-chlorophenyl)-1-methylcyclohex-4-ene-1,3-dicarboxylic acid (PubChem CID 151123239) has the molecular formula C15H14BrClO4 and a molecular weight of 373.63 g/mol. Its IUPAC name is 3-(2-bromo-5-chlorophenyl)-1-methylcyclohex-4-ene-1,3-dicarboxylic acid.
| Compound Name | 3-(2-bromo-5-chlorophenyl)-1-methylcyclohex-4-ene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 151123239 |
| Molecular Formula | C15H14BrClO4 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 3-(2-bromo-5-chlorophenyl)-1-methylcyclohex-4-ene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)CC=CC(C(=O)O)(c2cc(Cl)ccc2Br)C1 |
| InChI | InChI=1S/C15H14BrClO4/c1-14(12(18)19)5-2-6-15(8-14,13(20)21)10-7-9(17)3-4-11(10)16/h2-4,6-7H,5,8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | MSQFBUQEZZMALM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|