About 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid
8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid (PubChem CID 83672375) has the molecular formula C11H11ClO4
and a molecular weight of 242.66 g/mol. Its IUPAC name is 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid.
Molecular Properties
| Compound Name | 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid |
| PubChem CID | 83672375 |
| Molecular Formula | C11H11ClO4 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid |
| SMILES | O=C(O)C1(O)CCCOc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H11ClO4/c12-7-2-3-8-9(6-7)16-5-1-4-11(8,15)10(13)14/h2-3,6,15H,1,4-5H2,(H,13,14) |
| InChIKey | SIEBWAIYZJULFT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid?
The IUPAC name of 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid (CID 83672375) is 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid.
What is the SMILES notation for 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid?
The canonical SMILES for 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid is O=C(O)C1(O)CCCOc2cc(Cl)ccc21.
What is the InChIKey of 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid?
The InChIKey is SIEBWAIYZJULFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO4/c12-7-2-3-8-9(6-7)16-5-1-4-11(8,15)10(13)14/h2-3,6,15H,1,4-5H2,(H,13,14).
What are the key properties of 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid?
8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid has a molecular weight of 242.66 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5-hydroxy-3,4-dihydro-2H-1-benzoxepine-5-carboxylic acid is sourced from PubChem (CID 83672375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).