C10H9Cl2NO2 — CID 13053015
4,6-dichloro-2,3-dihydrochromene-4-carboxamide (PubChem CID 13053015) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 4,6-dichloro-2,3-dihydrochromene-4-carboxamide.
| Compound Name | 4,6-dichloro-2,3-dihydrochromene-4-carboxamide |
|---|---|
| PubChem CID | 13053015 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 4,6-dichloro-2,3-dihydrochromene-4-carboxamide |
| SMILES | NC(=O)C1(Cl)CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H9Cl2NO2/c11-6-1-2-8-7(5-6)10(12,9(13)14)3-4-15-8/h1-2,5H,3-4H2,(H2,13,14) |
| InChIKey | VQIGNEPBQSZICP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|