C16H13ClO3 — CID 135311490
6-chloro-4-phenyl-2,3-dihydrochromene-4-carboxylic acid (PubChem CID 135311490) has the molecular formula C16H13ClO3 and a molecular weight of 288.73 g/mol. Its IUPAC name is 6-chloro-4-phenyl-2,3-dihydrochromene-4-carboxylic acid.
| Compound Name | 6-chloro-4-phenyl-2,3-dihydrochromene-4-carboxylic acid |
|---|---|
| PubChem CID | 135311490 |
| Molecular Formula | C16H13ClO3 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 6-chloro-4-phenyl-2,3-dihydrochromene-4-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2)CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H13ClO3/c17-12-6-7-14-13(10-12)16(15(18)19,8-9-20-14)11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,18,19) |
| InChIKey | ONMWAXONCVYALZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |