C20H18Cl2O4 — CID 139725117
2-[1-(2-carboxy-4-chlorophenyl)cyclohexyl]-5-chlorobenzoic acid (PubChem CID 139725117) has the molecular formula C20H18Cl2O4 and a molecular weight of 393.27 g/mol. Its IUPAC name is 2-[1-(2-carboxy-4-chlorophenyl)cyclohexyl]-5-chlorobenzoic acid.
| Compound Name | 2-[1-(2-carboxy-4-chlorophenyl)cyclohexyl]-5-chlorobenzoic acid |
|---|---|
| PubChem CID | 139725117 |
| Molecular Formula | C20H18Cl2O4 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-[1-(2-carboxy-4-chlorophenyl)cyclohexyl]-5-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1C1(c2ccc(Cl)cc2C(=O)O)CCCCC1 |
| InChI | InChI=1S/C20H18Cl2O4/c21-12-4-6-16(14(10-12)18(23)24)20(8-2-1-3-9-20)17-7-5-13(22)11-15(17)19(25)26/h4-7,10-11H,1-3,8-9H2,(H,23,24)(H,25,26) |
| InChIKey | IIZWYKKWWSSTKI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |