C21H22ClNO3 — CID 46935602
5-chloro-2-[[4-(1-methylcyclohexyl)benzoyl]amino]benzoic acid (PubChem CID 46935602) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is 5-chloro-2-[[4-(1-methylcyclohexyl)benzoyl]amino]benzoic acid.
| Compound Name | 5-chloro-2-[[4-(1-methylcyclohexyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 46935602 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 5-chloro-2-[[4-(1-methylcyclohexyl)benzoyl]amino]benzoic acid |
| SMILES | CC1(c2ccc(C(=O)Nc3ccc(Cl)cc3C(=O)O)cc2)CCCCC1 |
| InChI | InChI=1S/C21H22ClNO3/c1-21(11-3-2-4-12-21)15-7-5-14(6-8-15)19(24)23-18-10-9-16(22)13-17(18)20(25)26/h5-10,13H,2-4,11-12H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | PCTLUDUFXUAGON-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |