C25H21Cl3N2O2 — CID 44530362
5-chloro-N-(4-chlorophenyl)-2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]amino]benzamide (PubChem CID 44530362) has the molecular formula C25H21Cl3N2O2 and a molecular weight of 487.81 g/mol. Its IUPAC name is 5-chloro-N-(4-chlorophenyl)-2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]amino]benzamide.
| Compound Name | 5-chloro-N-(4-chlorophenyl)-2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 44530362 |
| Molecular Formula | C25H21Cl3N2O2 |
| Molecular Weight | 487.81 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 5-chloro-N-(4-chlorophenyl)-2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc(Cl)ccc1NC(=O)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C25H21Cl3N2O2/c26-17-5-3-16(4-6-17)25(13-1-2-14-25)24(32)30-22-12-9-19(28)15-21(22)23(31)29-20-10-7-18(27)8-11-20/h3-12,15H,1-2,13-14H2,(H,29,31)(H,30,32) |
| InChIKey | YUFYBRCIUMFTIG-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.81 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |