C9H10Cl2N2 — CID 131186746
(1S)-1-(3,5-dichloro-4-pyridinyl)but-3-en-1-amine (PubChem CID 131186746) has the molecular formula C9H10Cl2N2 and a molecular weight of 217.10 g/mol. Its IUPAC name is (1S)-1-(3,5-dichloro-4-pyridinyl)but-3-en-1-amine.
| Compound Name | (1S)-1-(3,5-dichloro-4-pyridinyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 131186746 |
| Molecular Formula | C9H10Cl2N2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | (1S)-1-(3,5-dichloro-4-pyridinyl)but-3-en-1-amine |
| SMILES | C=CC[C@H](N)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C9H10Cl2N2/c1-2-3-8(12)9-6(10)4-13-5-7(9)11/h2,4-5,8H,1,3,12H2/t8-/m0/s1 |
| InChIKey | FCUNHGQWRIZATP-QMMMGPOBSA-N |
| XLogP | 2.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|