C8H10F2N2S — CID 131196456
3-(2,2-difluorocyclopentyl)-1H-imidazole-2-thione (PubChem CID 131196456) has the molecular formula C8H10F2N2S and a molecular weight of 204.24 g/mol. Its IUPAC name is 3-(2,2-difluorocyclopentyl)-1H-imidazole-2-thione.
| Compound Name | 3-(2,2-difluorocyclopentyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 131196456 |
| Molecular Formula | C8H10F2N2S |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-(2,2-difluorocyclopentyl)-1H-imidazole-2-thione |
| SMILES | FC1(F)CCCC1n1cc[nH]c1=S |
| InChI | InChI=1S/C8H10F2N2S/c9-8(10)3-1-2-6(8)12-5-4-11-7(12)13/h4-6H,1-3H2,(H,11,13) |
| InChIKey | JCDQWNJGMBTPCN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|