C9H12F2N2S — CID 127017386
3-(3,3-difluorocyclopentyl)-4-methyl-1H-imidazole-2-thione (PubChem CID 127017386) has the molecular formula C9H12F2N2S and a molecular weight of 218.27 g/mol. Its IUPAC name is 3-(3,3-difluorocyclopentyl)-4-methyl-1H-imidazole-2-thione.
| Compound Name | 3-(3,3-difluorocyclopentyl)-4-methyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 127017386 |
| Molecular Formula | C9H12F2N2S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 3-(3,3-difluorocyclopentyl)-4-methyl-1H-imidazole-2-thione |
| SMILES | Cc1c[nH]c(=S)n1C1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H12F2N2S/c1-6-5-12-8(14)13(6)7-2-3-9(10,11)4-7/h5,7H,2-4H2,1H3,(H,12,14) |
| InChIKey | LPLBYHBQJHPFDF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|