C9H14N2O — CID 131198163
2,5-dihydropyrrol-1-yl-(3-methylazetidin-3-yl)methanone (PubChem CID 131198163) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,5-dihydropyrrol-1-yl-(3-methylazetidin-3-yl)methanone.
| Compound Name | 2,5-dihydropyrrol-1-yl-(3-methylazetidin-3-yl)methanone |
|---|---|
| PubChem CID | 131198163 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2,5-dihydropyrrol-1-yl-(3-methylazetidin-3-yl)methanone |
| SMILES | CC1(C(=O)N2CC=CC2)CNC1 |
| InChI | InChI=1S/C9H14N2O/c1-9(6-10-7-9)8(12)11-4-2-3-5-11/h2-3,10H,4-7H2,1H3 |
| InChIKey | XQYYOFUEYYYMON-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|