C17H34N4O — CID 174397328
bis(2,2,6,6-tetramethylpiperazin-1-yl)methanone (PubChem CID 174397328) has the molecular formula C17H34N4O and a molecular weight of 310.49 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperazin-1-yl)methanone.
| Compound Name | bis(2,2,6,6-tetramethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 174397328 |
| Molecular Formula | C17H34N4O |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperazin-1-yl)methanone |
| SMILES | CC1(C)CNCC(C)(C)N1C(=O)N1C(C)(C)CNCC1(C)C |
| InChI | InChI=1S/C17H34N4O/c1-14(2)9-18-10-15(3,4)20(14)13(22)21-16(5,6)11-19-12-17(21,7)8/h18-19H,9-12H2,1-8H3 |
| InChIKey | FMMNVXPZWGIXQS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |