C16H20F3N3O — CID 171439279
(3-methylazetidin-3-yl)-[4-[4-(trifluoromethyl)-3-pyridinyl]piperidin-1-yl]methanone (PubChem CID 171439279) has the molecular formula C16H20F3N3O and a molecular weight of 327.35 g/mol. Its IUPAC name is (3-methylazetidin-3-yl)-[4-[4-(trifluoromethyl)-3-pyridinyl]piperidin-1-yl]methanone.
| Compound Name | (3-methylazetidin-3-yl)-[4-[4-(trifluoromethyl)-3-pyridinyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 171439279 |
| Molecular Formula | C16H20F3N3O |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (3-methylazetidin-3-yl)-[4-[4-(trifluoromethyl)-3-pyridinyl]piperidin-1-yl]methanone |
| SMILES | CC1(C(=O)N2CCC(c3cnccc3C(F)(F)F)CC2)CNC1 |
| InChI | InChI=1S/C16H20F3N3O/c1-15(9-21-10-15)14(23)22-6-3-11(4-7-22)12-8-20-5-2-13(12)16(17,18)19/h2,5,8,11,21H,3-4,6-7,9-10H2,1H3 |
| InChIKey | IGMQPFBEAXUGJL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |