C11H10F5N — CID 174946323
3-(3,3-difluorocyclopentyl)-4-(trifluoromethyl)pyridine (PubChem CID 174946323) has the molecular formula C11H10F5N and a molecular weight of 251.20 g/mol. Its IUPAC name is 3-(3,3-difluorocyclopentyl)-4-(trifluoromethyl)pyridine.
| Compound Name | 3-(3,3-difluorocyclopentyl)-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 174946323 |
| Molecular Formula | C11H10F5N |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-(3,3-difluorocyclopentyl)-4-(trifluoromethyl)pyridine |
| SMILES | FC1(F)CCC(c2cnccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C11H10F5N/c12-10(13)3-1-7(5-10)8-6-17-4-2-9(8)11(14,15)16/h2,4,6-7H,1,3,5H2 |
| InChIKey | ZUEFWIVITSLVAF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |