C11H19F2NO2 — CID 131208970
N-(2,2-difluoropropyl)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 131208970) has the molecular formula C11H19F2NO2 and a molecular weight of 235.27 g/mol. Its IUPAC name is N-(2,2-difluoropropyl)-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-(2,2-difluoropropyl)-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 131208970 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-(2,2-difluoropropyl)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | CC(F)(F)CNC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C11H19F2NO2/c1-10(12,13)8-14-9-2-4-11(5-3-9)15-6-7-16-11/h9,14H,2-8H2,1H3 |
| InChIKey | DTFJIQKMDOPWFI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |