C11H13Cl2NO2 — CID 131209122
2,5-dichloro-N-[2-(1,3-dioxolan-2-yl)ethyl]aniline (PubChem CID 131209122) has the molecular formula C11H13Cl2NO2 and a molecular weight of 262.14 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(1,3-dioxolan-2-yl)ethyl]aniline.
| Compound Name | 2,5-dichloro-N-[2-(1,3-dioxolan-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 131209122 |
| Molecular Formula | C11H13Cl2NO2 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 2,5-dichloro-N-[2-(1,3-dioxolan-2-yl)ethyl]aniline |
| SMILES | Clc1ccc(Cl)c(NCCC2OCCO2)c1 |
| InChI | InChI=1S/C11H13Cl2NO2/c12-8-1-2-9(13)10(7-8)14-4-3-11-15-5-6-16-11/h1-2,7,11,14H,3-6H2 |
| InChIKey | XHIMHUYKWLZSTM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |