C7H10ClN3 — CID 131222986
3-chloro-1-pent-4-enyl-1,2,4-triazole (PubChem CID 131222986) has the molecular formula C7H10ClN3 and a molecular weight of 171.63 g/mol. Its IUPAC name is 3-chloro-1-pent-4-enyl-1,2,4-triazole.
| Compound Name | 3-chloro-1-pent-4-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 131222986 |
| Molecular Formula | C7H10ClN3 |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 3-chloro-1-pent-4-enyl-1,2,4-triazole |
| SMILES | C=CCCCn1cnc(Cl)n1 |
| InChI | InChI=1S/C7H10ClN3/c1-2-3-4-5-11-6-9-7(8)10-11/h2,6H,1,3-5H2 |
| InChIKey | HQPHJBDUCUNDFU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|