C8H13N3 — CID 140994090
1-(2-ethylbut-3-enyl)-1,2,4-triazole (PubChem CID 140994090) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-(2-ethylbut-3-enyl)-1,2,4-triazole.
| Compound Name | 1-(2-ethylbut-3-enyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 140994090 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-(2-ethylbut-3-enyl)-1,2,4-triazole |
| SMILES | C=CC(CC)Cn1cncn1 |
| InChI | InChI=1S/C8H13N3/c1-3-8(4-2)5-11-7-9-6-10-11/h3,6-8H,1,4-5H2,2H3 |
| InChIKey | GIVIJERWYJKEHK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|