C10H19N3Si — CID 140982525
trimethyl-[5-(1,2,4-triazol-1-yl)pent-1-en-3-yl]silane (PubChem CID 140982525) has the molecular formula C10H19N3Si and a molecular weight of 209.37 g/mol. Its IUPAC name is trimethyl-[5-(1,2,4-triazol-1-yl)pent-1-en-3-yl]silane.
| Compound Name | trimethyl-[5-(1,2,4-triazol-1-yl)pent-1-en-3-yl]silane |
|---|---|
| PubChem CID | 140982525 |
| Molecular Formula | C10H19N3Si |
| Molecular Weight | 209.37 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | trimethyl-[5-(1,2,4-triazol-1-yl)pent-1-en-3-yl]silane |
| SMILES | C=CC(CCn1cncn1)[Si](C)(C)C |
| InChI | InChI=1S/C10H19N3Si/c1-5-10(14(2,3)4)6-7-13-9-11-8-12-13/h5,8-10H,1,6-7H2,2-4H3 |
| InChIKey | HVGNRQNGWWHCGW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|