C12H17N3O2S — CID 131227646
3-benzyl-6-(sulfamoylamino)-3-azabicyclo[3.1.0]hexane (PubChem CID 131227646) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-benzyl-6-(sulfamoylamino)-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-benzyl-6-(sulfamoylamino)-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 131227646 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-benzyl-6-(sulfamoylamino)-3-azabicyclo[3.1.0]hexane |
| SMILES | NS(=O)(=O)NC1C2CN(Cc3ccccc3)CC21 |
| InChI | InChI=1S/C12H17N3O2S/c13-18(16,17)14-12-10-7-15(8-11(10)12)6-9-4-2-1-3-5-9/h1-5,10-12,14H,6-8H2,(H2,13,16,17) |
| InChIKey | UWZGSESZDHMWSZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |