C15H20O3S — CID 13123123
(4S,5R)-5-tert-butyl-4-[(R)-(4-methylphenyl)sulfinyl]oxolan-2-one (PubChem CID 13123123) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is (4S,5R)-5-tert-butyl-4-[(R)-(4-methylphenyl)sulfinyl]oxolan-2-one.
| Compound Name | (4S,5R)-5-tert-butyl-4-[(R)-(4-methylphenyl)sulfinyl]oxolan-2-one |
|---|---|
| PubChem CID | 13123123 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (4S,5R)-5-tert-butyl-4-[(R)-(4-methylphenyl)sulfinyl]oxolan-2-one |
| SMILES | Cc1ccc([S@](=O)[C@H]2CC(=O)O[C@@H]2C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H20O3S/c1-10-5-7-11(8-6-10)19(17)12-9-13(16)18-14(12)15(2,3)4/h5-8,12,14H,9H2,1-4H3/t12-,14-,19-/m0/s1 |
| InChIKey | BLBNHTCZVJMSAH-PJFSTRORSA-N |
| XLogP | 2.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |