C8H10O3 — CID 131236814
methyl (E,4S)-4-hydroxyhept-5-en-2-ynoate (PubChem CID 131236814) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is methyl (E,4S)-4-hydroxyhept-5-en-2-ynoate.
| Compound Name | methyl (E,4S)-4-hydroxyhept-5-en-2-ynoate |
|---|---|
| PubChem CID | 131236814 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | methyl (E,4S)-4-hydroxyhept-5-en-2-ynoate |
| SMILES | C/C=C/[C@H](O)C#CC(=O)OC |
| InChI | InChI=1S/C8H10O3/c1-3-4-7(9)5-6-8(10)11-2/h3-4,7,9H,1-2H3/b4-3+/t7-/m0/s1 |
| InChIKey | UGBLIQQMBCQFIA-SDLBARTOSA-N |
| XLogP | 0.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|