C11H20ClNOS — CID 131237496
4-[(E)-4-chlorobut-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide (PubChem CID 131237496) has the molecular formula C11H20ClNOS and a molecular weight of 249.81 g/mol. Its IUPAC name is 4-[(E)-4-chlorobut-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide.
| Compound Name | 4-[(E)-4-chlorobut-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 131237496 |
| Molecular Formula | C11H20ClNOS |
| Molecular Weight | 249.81 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-[(E)-4-chlorobut-2-enyl]-7,7-dimethyl-1,4-thiazepane 1-oxide |
| SMILES | CC1(C)CCN(C/C=C/CCl)CCS1=O |
| InChI | InChI=1S/C11H20ClNOS/c1-11(2)5-8-13(7-4-3-6-12)9-10-15(11)14/h3-4H,5-10H2,1-2H3/b4-3+ |
| InChIKey | XLRKHAUYSKBAAI-ONEGZZNKSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.81 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|