About [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene
[(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene (PubChem CID 13124322) has the molecular formula C10H9ClS
and a molecular weight of 196.70 g/mol. Its IUPAC name is [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene.
Molecular Properties
| Compound Name | [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene |
| PubChem CID | 13124322 |
| Molecular Formula | C10H9ClS |
| Molecular Weight | 196.70 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene |
| SMILES | C=C(/C=C/Cl)Sc1ccccc1 |
| InChI | InChI=1S/C10H9ClS/c1-9(7-8-11)12-10-5-3-2-4-6-10/h2-8H,1H2/b8-7+ |
| InChIKey | WDCHLYWJIFLVMM-BQYQJAHWSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.70 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene?
The IUPAC name of [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene (CID 13124322) is [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene.
What is the SMILES notation for [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene?
The canonical SMILES for [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene is C=C(/C=C/Cl)Sc1ccccc1.
What is the InChIKey of [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene?
The InChIKey is WDCHLYWJIFLVMM-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H9ClS/c1-9(7-8-11)12-10-5-3-2-4-6-10/h2-8H,1H2/b8-7+.
What are the key properties of [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene?
[(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene has a molecular weight of 196.70 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-4-chlorobuta-1,3-dien-2-yl]sulfanylbenzene is sourced from PubChem (CID 13124322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).