About S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate
S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate (PubChem CID 13085115) has the molecular formula C13H14Cl2OS
and a molecular weight of 289.23 g/mol. Its IUPAC name is S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate.
Molecular Properties
| Compound Name | S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate |
| PubChem CID | 13085115 |
| Molecular Formula | C13H14Cl2OS |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate |
| SMILES | C=CC(C)(C)C(Cl)(Cl)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C13H14Cl2OS/c1-4-12(2,3)13(14,15)11(16)17-10-8-6-5-7-9-10/h4-9H,1H2,2-3H3 |
| InChIKey | CQILVPWDQLJUMB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate?
The IUPAC name of S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate (CID 13085115) is S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate.
What is the SMILES notation for S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate?
The canonical SMILES for S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate is C=CC(C)(C)C(Cl)(Cl)C(=O)Sc1ccccc1.
What is the InChIKey of S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate?
The InChIKey is CQILVPWDQLJUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2OS/c1-4-12(2,3)13(14,15)11(16)17-10-8-6-5-7-9-10/h4-9H,1H2,2-3H3.
What are the key properties of S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate?
S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate has a molecular weight of 289.23 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl 2,2-dichloro-3,3-dimethylpent-4-enethioate is sourced from PubChem (CID 13085115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).