C16H26O2SSi — CID 173416676
S-phenyl 2,3,3,4,4-pentamethyl-2-silyloxypentanethioate (PubChem CID 173416676) has the molecular formula C16H26O2SSi and a molecular weight of 310.53 g/mol. Its IUPAC name is S-phenyl 2,3,3,4,4-pentamethyl-2-silyloxypentanethioate.
| Compound Name | S-phenyl 2,3,3,4,4-pentamethyl-2-silyloxypentanethioate |
|---|---|
| PubChem CID | 173416676 |
| Molecular Formula | C16H26O2SSi |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | S-phenyl 2,3,3,4,4-pentamethyl-2-silyloxypentanethioate |
| SMILES | CC(C)(C)C(C)(C)C(C)(O[SiH3])C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C16H26O2SSi/c1-14(2,3)15(4,5)16(6,18-20)13(17)19-12-10-8-7-9-11-12/h7-11H,1-6,20H3 |
| InChIKey | CQLXNZBJTXJDOO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|