About N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine
N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine (PubChem CID 131248157) has the molecular formula C9H18ClN
and a molecular weight of 175.70 g/mol. Its IUPAC name is N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine.
Analyze N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine?
The IUPAC name of N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine (CID 131248157) is N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine.
What is the SMILES notation for N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine?
The canonical SMILES for N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine is CC(C)C(C)N(C)C/C=C/Cl.
What is the InChIKey of N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine?
The InChIKey is XDGDWZKWSRQTID-AATRIKPKSA-N. The full InChI is InChI=1S/C9H18ClN/c1-8(2)9(3)11(4)7-5-6-10/h5-6,8-9H,7H2,1-4H3/b6-5+.
What are the key properties of N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine?
N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine has a molecular weight of 175.70 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3-chloroprop-2-enyl]-N,3-dimethylbutan-2-amine is sourced from PubChem (CID 131248157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).