About N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane
N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane (PubChem CID 173211748) has the molecular formula C6H13Cl2NSi
and a molecular weight of 198.17 g/mol. Its IUPAC name is N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane.
Molecular Properties
| Compound Name | N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane |
| PubChem CID | 173211748 |
| Molecular Formula | C6H13Cl2NSi |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane |
| SMILES | C=CCN(Cl)CC=CCl.[SiH4] |
| InChI | InChI=1S/C6H9Cl2N.H4Si/c1-2-5-9(8)6-3-4-7;/h2-4H,1,5-6H2;1H4 |
| InChIKey | QXTKNIFVWLRNQD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane?
The IUPAC name of N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane (CID 173211748) is N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane.
What is the SMILES notation for N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane?
The canonical SMILES for N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane is C=CCN(Cl)CC=CCl.[SiH4].
What is the InChIKey of N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane?
The InChIKey is QXTKNIFVWLRNQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9Cl2N.H4Si/c1-2-5-9(8)6-3-4-7;/h2-4H,1,5-6H2;1H4.
What are the key properties of N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane?
N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane has a molecular weight of 198.17 g/mol, XLogP of 0.93, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane is sourced from PubChem (CID 173211748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).