C6H13Cl2NSi — CID 173211748
N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane (PubChem CID 173211748) has the molecular formula C6H13Cl2NSi and a molecular weight of 198.17 g/mol. Its IUPAC name is N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane.
| Compound Name | N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane |
|---|---|
| PubChem CID | 173211748 |
| Molecular Formula | C6H13Cl2NSi |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | N,3-dichloro-N-prop-2-enylprop-2-en-1-amine;silane |
| SMILES | C=CCN(Cl)CC=CCl.[SiH4] |
| InChI | InChI=1S/C6H9Cl2N.H4Si/c1-2-5-9(8)6-3-4-7;/h2-4H,1,5-6H2;1H4 |
| InChIKey | QXTKNIFVWLRNQD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|