C3H5Br2N — CID 19789972
N,N-dibromoprop-2-en-1-amine (PubChem CID 19789972) has the molecular formula C3H5Br2N and a molecular weight of 214.89 g/mol. Its IUPAC name is N,N-dibromoprop-2-en-1-amine.
| Compound Name | N,N-dibromoprop-2-en-1-amine |
|---|---|
| PubChem CID | 19789972 |
| Molecular Formula | C3H5Br2N |
| Molecular Weight | 214.89 g/mol |
| Exact Mass | 212.88 |
| IUPAC Name | N,N-dibromoprop-2-en-1-amine |
| SMILES | C=CCN(Br)Br |
| InChI | InChI=1S/C3H5Br2N/c1-2-3-6(4)5/h2H,1,3H2 |
| InChIKey | ZACDGDBJHKGPQS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.89 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|