About 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride
1,1-bis(prop-2-enyl)hydrazine;dihydrochloride (PubChem CID 174545324) has the molecular formula C6H14Cl2N2
and a molecular weight of 185.10 g/mol. Its IUPAC name is 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride.
Molecular Properties
| Compound Name | 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride |
| PubChem CID | 174545324 |
| Molecular Formula | C6H14Cl2N2 |
| Molecular Weight | 185.10 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride |
| SMILES | C=CCN(N)CC=C.Cl.Cl |
| InChI | InChI=1S/C6H12N2.2ClH/c1-3-5-8(7)6-4-2;;/h3-4H,1-2,5-7H2;2*1H |
| InChIKey | XVTGSUMXJYMLKE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.10 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride?
The IUPAC name of 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride (CID 174545324) is 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride.
What is the SMILES notation for 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride?
The canonical SMILES for 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride is C=CCN(N)CC=C.Cl.Cl.
What is the InChIKey of 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride?
The InChIKey is XVTGSUMXJYMLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.2ClH/c1-3-5-8(7)6-4-2;;/h3-4H,1-2,5-7H2;2*1H.
What are the key properties of 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride?
1,1-bis(prop-2-enyl)hydrazine;dihydrochloride has a molecular weight of 185.10 g/mol, XLogP of 1.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(prop-2-enyl)hydrazine;dihydrochloride is sourced from PubChem (CID 174545324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).