C6H11NS — CID 87220741
N,N-bis(prop-2-enyl)thiohydroxylamine (PubChem CID 87220741) has the molecular formula C6H11NS and a molecular weight of 129.23 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)thiohydroxylamine.
| Compound Name | N,N-bis(prop-2-enyl)thiohydroxylamine |
|---|---|
| PubChem CID | 87220741 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | N,N-bis(prop-2-enyl)thiohydroxylamine |
| SMILES | C=CCN(S)CC=C |
| InChI | InChI=1S/C6H11NS/c1-3-5-7(8)6-4-2/h3-4,8H,1-2,5-6H2 |
| InChIKey | ZFKZFXGKZJGYTG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|