C10H18ClNO — CID 57377208
(2S)-5-chloro-N,N-dimethyl-2-propan-2-ylpent-4-enamide (PubChem CID 57377208) has the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. Its IUPAC name is (2S)-5-chloro-N,N-dimethyl-2-propan-2-ylpent-4-enamide.
| Compound Name | (2S)-5-chloro-N,N-dimethyl-2-propan-2-ylpent-4-enamide |
|---|---|
| PubChem CID | 57377208 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (2S)-5-chloro-N,N-dimethyl-2-propan-2-ylpent-4-enamide |
| SMILES | CC(C)[C@H](CC=CCl)C(=O)N(C)C |
| InChI | InChI=1S/C10H18ClNO/c1-8(2)9(6-5-7-11)10(13)12(3)4/h5,7-9H,6H2,1-4H3/t9-/m0/s1 |
| InChIKey | MFPMAEZQAUDONN-VIFPVBQESA-N |
| XLogP | 2.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |