C16H29NO — CID 54149677
(2S)-6-cyclopentyl-N,N-dimethyl-2-propan-2-ylhex-4-enamide (PubChem CID 54149677) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (2S)-6-cyclopentyl-N,N-dimethyl-2-propan-2-ylhex-4-enamide.
| Compound Name | (2S)-6-cyclopentyl-N,N-dimethyl-2-propan-2-ylhex-4-enamide |
|---|---|
| PubChem CID | 54149677 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (2S)-6-cyclopentyl-N,N-dimethyl-2-propan-2-ylhex-4-enamide |
| SMILES | CC(C)[C@H](CC=CCC1CCCC1)C(=O)N(C)C |
| InChI | InChI=1S/C16H29NO/c1-13(2)15(16(18)17(3)4)12-8-7-11-14-9-5-6-10-14/h7-8,13-15H,5-6,9-12H2,1-4H3/t15-/m0/s1 |
| InChIKey | OGWFIVFEDFABAC-HNNXBMFYSA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|