C15H28 — CID 57295731
5,6-dimethylhept-2-enylcyclohexane (PubChem CID 57295731) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 5,6-dimethylhept-2-enylcyclohexane.
| Compound Name | 5,6-dimethylhept-2-enylcyclohexane |
|---|---|
| PubChem CID | 57295731 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 5,6-dimethylhept-2-enylcyclohexane |
| SMILES | CC(C)C(C)CC=CCC1CCCCC1 |
| InChI | InChI=1S/C15H28/c1-13(2)14(3)9-7-8-12-15-10-5-4-6-11-15/h7-8,13-15H,4-6,9-12H2,1-3H3 |
| InChIKey | HQCZSWSORSHLAL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|