C28H36Cl2N8O5 — CID 13126113
dibutyl 2-[[3,5-dichloro-4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioate (PubChem CID 13126113) has the molecular formula C28H36Cl2N8O5 and a molecular weight of 635.55 g/mol. Its IUPAC name is dibutyl 2-[[3,5-dichloro-4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioate.
| Compound Name | dibutyl 2-[[3,5-dichloro-4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 13126113 |
| Molecular Formula | C28H36Cl2N8O5 |
| Molecular Weight | 635.55 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | dibutyl 2-[[3,5-dichloro-4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioate |
| SMILES | CCCCOC(=O)CCC(NC(=O)c1cc(Cl)c(N(C)Cc2cnc3nc(N)nc(N)c3n2)c(Cl)c1)C(=O)OCCCC |
| InChI | InChI=1S/C28H36Cl2N8O5/c1-4-6-10-42-21(39)9-8-20(27(41)43-11-7-5-2)35-26(40)16-12-18(29)23(19(30)13-16)38(3)15-17-14-33-25-22(34-17)24(31)36-28(32)37-25/h12-14,20H,4-11,15H2,1-3H3,(H,35,40)(H4,31,32,33,36,37) |
| InChIKey | ZFYMHDCVGAVTMX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 188.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|