C6H6N6 — CID 131286114
2-(1,2,4-triazol-4-yl)pyrimidin-4-amine (PubChem CID 131286114) has the molecular formula C6H6N6 and a molecular weight of 162.16 g/mol. Its IUPAC name is 2-(1,2,4-triazol-4-yl)pyrimidin-4-amine.
| Compound Name | 2-(1,2,4-triazol-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 131286114 |
| Molecular Formula | C6H6N6 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 2-(1,2,4-triazol-4-yl)pyrimidin-4-amine |
| SMILES | Nc1ccnc(-n2cnnc2)n1 |
| InChI | InChI=1S/C6H6N6/c7-5-1-2-8-6(11-5)12-3-9-10-4-12/h1-4H,(H2,7,8,11) |
| InChIKey | VBIAJOFYDVZKPM-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |