C11H21NO3 — CID 13129891
5-(dimethoxymethyl)-3-pentyl-4,5-dihydro-1,2-oxazole (PubChem CID 13129891) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 5-(dimethoxymethyl)-3-pentyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(dimethoxymethyl)-3-pentyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 13129891 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 5-(dimethoxymethyl)-3-pentyl-4,5-dihydro-1,2-oxazole |
| SMILES | CCCCCC1=NOC(C(OC)OC)C1 |
| InChI | InChI=1S/C11H21NO3/c1-4-5-6-7-9-8-10(15-12-9)11(13-2)14-3/h10-11H,4-8H2,1-3H3 |
| InChIKey | IQKQMBWBDVVJPU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|