About copper(1+);4-methylthiobenzate
copper(1+);4-methylthiobenzate (PubChem CID 13131237) has the molecular formula C8H7CuOS
and a molecular weight of 214.76 g/mol. Its IUPAC name is copper(1+);4-methylthiobenzate.
Molecular Properties
| Compound Name | copper(1+);4-methylthiobenzate |
| PubChem CID | 13131237 |
| Molecular Formula | C8H7CuOS |
| Molecular Weight | 214.76 g/mol |
| Exact Mass | 213.95 |
| IUPAC Name | copper(1+);4-methylthiobenzate |
| SMILES | Cc1ccc(C(=O)[S-])cc1.[Cu+] |
| InChI | InChI=1S/C8H8OS.Cu/c1-6-2-4-7(5-3-6)8(9)10;/h2-5H,1H3,(H,9,10);/q;+1/p-1 |
| InChIKey | SVJFYYBRDCGGFF-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.76 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);4-methylthiobenzate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);4-methylthiobenzate?
The IUPAC name of copper(1+);4-methylthiobenzate (CID 13131237) is copper(1+);4-methylthiobenzate.
What is the SMILES notation for copper(1+);4-methylthiobenzate?
The canonical SMILES for copper(1+);4-methylthiobenzate is Cc1ccc(C(=O)[S-])cc1.[Cu+].
What is the InChIKey of copper(1+);4-methylthiobenzate?
The InChIKey is SVJFYYBRDCGGFF-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8OS.Cu/c1-6-2-4-7(5-3-6)8(9)10;/h2-5H,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of copper(1+);4-methylthiobenzate?
copper(1+);4-methylthiobenzate has a molecular weight of 214.76 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);4-methylthiobenzate is sourced from PubChem (CID 13131237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).