C13H11ClN2O2S — CID 13131700
6-[(2-chlorophenyl)methyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione (PubChem CID 13131700) has the molecular formula C13H11ClN2O2S and a molecular weight of 294.76 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione.
| Compound Name | 6-[(2-chlorophenyl)methyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 13131700 |
| Molecular Formula | C13H11ClN2O2S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 6-[(2-chlorophenyl)methyl]-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-5,7-dione |
| SMILES | O=C1N=C2SCCN2C(=O)C1Cc1ccccc1Cl |
| InChI | InChI=1S/C13H11ClN2O2S/c14-10-4-2-1-3-8(10)7-9-11(17)15-13-16(12(9)18)5-6-19-13/h1-4,9H,5-7H2 |
| InChIKey | ZMZHOVPNAGLSII-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|