C19H16ClN3O2 — CID 101455921
6-[(2-chlorophenyl)methyl]-1-phenyl-2,3-dihydroimidazo[1,2-a]pyrimidine-5,7-dione (PubChem CID 101455921) has the molecular formula C19H16ClN3O2 and a molecular weight of 353.81 g/mol. Its IUPAC name is 6-[(2-chlorophenyl)methyl]-1-phenyl-2,3-dihydroimidazo[1,2-a]pyrimidine-5,7-dione.
| Compound Name | 6-[(2-chlorophenyl)methyl]-1-phenyl-2,3-dihydroimidazo[1,2-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 101455921 |
| Molecular Formula | C19H16ClN3O2 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 6-[(2-chlorophenyl)methyl]-1-phenyl-2,3-dihydroimidazo[1,2-a]pyrimidine-5,7-dione |
| SMILES | O=C1N=C2N(CCN2c2ccccc2)C(=O)C1Cc1ccccc1Cl |
| InChI | InChI=1S/C19H16ClN3O2/c20-16-9-5-4-6-13(16)12-15-17(24)21-19-22(10-11-23(19)18(15)25)14-7-2-1-3-8-14/h1-9,15H,10-12H2 |
| InChIKey | XOLPRPYWCWTUCR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|