About 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol
3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol (PubChem CID 131346171) has the molecular formula C8H13Cl2NO
and a molecular weight of 210.10 g/mol. Its IUPAC name is 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol |
| PubChem CID | 131346171 |
| Molecular Formula | C8H13Cl2NO |
| Molecular Weight | 210.10 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol |
| SMILES | CN(C/C(Cl)=C/Cl)C1CC(O)C1 |
| InChI | InChI=1S/C8H13Cl2NO/c1-11(5-6(10)4-9)7-2-8(12)3-7/h4,7-8,12H,2-3,5H2,1H3/b6-4- |
| InChIKey | RXRYUGWSVJZSEG-XQRVVYSFSA-N |
| XLogP | 1.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.10 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol?
The IUPAC name of 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol (CID 131346171) is 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol.
What is the SMILES notation for 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol?
The canonical SMILES for 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol is CN(C/C(Cl)=C/Cl)C1CC(O)C1.
What is the InChIKey of 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol?
The InChIKey is RXRYUGWSVJZSEG-XQRVVYSFSA-N. The full InChI is InChI=1S/C8H13Cl2NO/c1-11(5-6(10)4-9)7-2-8(12)3-7/h4,7-8,12H,2-3,5H2,1H3/b6-4-.
What are the key properties of 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol?
3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol has a molecular weight of 210.10 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(Z)-2,3-dichloroprop-2-enyl]-methylamino]cyclobutan-1-ol is sourced from PubChem (CID 131346171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).