C9H17NO2 — CID 131043860
N-(3-hydroxycyclobutyl)-N,2-dimethylpropanamide (PubChem CID 131043860) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is N-(3-hydroxycyclobutyl)-N,2-dimethylpropanamide.
| Compound Name | N-(3-hydroxycyclobutyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 131043860 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | N-(3-hydroxycyclobutyl)-N,2-dimethylpropanamide |
| SMILES | CC(C)C(=O)N(C)C1CC(O)C1 |
| InChI | InChI=1S/C9H17NO2/c1-6(2)9(12)10(3)7-4-8(11)5-7/h6-8,11H,4-5H2,1-3H3 |
| InChIKey | CHUYOHPHQLTMIB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |