C23H29NO3 — CID 163312810
(2S)-N-[(3aS,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-(6-methoxynaphthalen-2-yl)-N-methylpropanamide (PubChem CID 163312810) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (2S)-N-[(3aS,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-(6-methoxynaphthalen-2-yl)-N-methylpropanamide.
| Compound Name | (2S)-N-[(3aS,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-(6-methoxynaphthalen-2-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 163312810 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2S)-N-[(3aS,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-(6-methoxynaphthalen-2-yl)-N-methylpropanamide |
| SMILES | COc1ccc2cc([C@H](C)C(=O)N(C)C3C[C@H]4CC(O)C[C@H]4C3)ccc2c1 |
| InChI | InChI=1S/C23H29NO3/c1-14(15-4-5-17-13-22(27-3)7-6-16(17)8-15)23(26)24(2)20-9-18-11-21(25)12-19(18)10-20/h4-8,13-14,18-21,25H,9-12H2,1-3H3/t14-,18-,19+,20?,21?/m0/s1 |
| InChIKey | SXVKBUZTYRIAAK-HYWNPFCZSA-N |
| XLogP | 3.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |