C8H15NO3 — CID 126991101
2-hydroxy-N-(3-hydroxycyclobutyl)-N-methylpropanamide (PubChem CID 126991101) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-hydroxy-N-(3-hydroxycyclobutyl)-N-methylpropanamide.
| Compound Name | 2-hydroxy-N-(3-hydroxycyclobutyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 126991101 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-hydroxy-N-(3-hydroxycyclobutyl)-N-methylpropanamide |
| SMILES | CC(O)C(=O)N(C)C1CC(O)C1 |
| InChI | InChI=1S/C8H15NO3/c1-5(10)8(12)9(2)6-3-7(11)4-6/h5-7,10-11H,3-4H2,1-2H3 |
| InChIKey | GTEIFZCSTLHXIS-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |