C8H5F4N3O — CID 131392806
6-amino-2-(fluoromethyl)-4-(trifluoromethoxy)pyridine-3-carbonitrile (PubChem CID 131392806) has the molecular formula C8H5F4N3O and a molecular weight of 235.14 g/mol. Its IUPAC name is 6-amino-2-(fluoromethyl)-4-(trifluoromethoxy)pyridine-3-carbonitrile.
| Compound Name | 6-amino-2-(fluoromethyl)-4-(trifluoromethoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 131392806 |
| Molecular Formula | C8H5F4N3O |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 6-amino-2-(fluoromethyl)-4-(trifluoromethoxy)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(OC(F)(F)F)cc(N)nc1CF |
| InChI | InChI=1S/C8H5F4N3O/c9-2-5-4(3-13)6(1-7(14)15-5)16-8(10,11)12/h1H,2H2,(H2,14,15) |
| InChIKey | XEPDYKOLDVOMCY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |