C8H5ClF3N3O — CID 131612363
6-amino-4-(chloromethyl)-2-(trifluoromethoxy)pyridine-3-carbonitrile (PubChem CID 131612363) has the molecular formula C8H5ClF3N3O and a molecular weight of 251.59 g/mol. Its IUPAC name is 6-amino-4-(chloromethyl)-2-(trifluoromethoxy)pyridine-3-carbonitrile.
| Compound Name | 6-amino-4-(chloromethyl)-2-(trifluoromethoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 131612363 |
| Molecular Formula | C8H5ClF3N3O |
| Molecular Weight | 251.59 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | 6-amino-4-(chloromethyl)-2-(trifluoromethoxy)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(CCl)cc(N)nc1OC(F)(F)F |
| InChI | InChI=1S/C8H5ClF3N3O/c9-2-4-1-6(14)15-7(5(4)3-13)16-8(10,11)12/h1H,2H2,(H2,14,15) |
| InChIKey | PLOCIHBJFXMPMN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|