About 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid
2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid (PubChem CID 131409068) has the molecular formula C10H9NO4S
and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid.
Analyze 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid?
The IUPAC name of 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid (CID 131409068) is 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid.
What is the SMILES notation for 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid?
The canonical SMILES for 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid is CSc1ccc2oc(C(O)C(=O)O)nc2c1.
What is the InChIKey of 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid?
The InChIKey is CQYOECPFOBVQDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4S/c1-16-5-2-3-7-6(4-5)11-9(15-7)8(12)10(13)14/h2-4,8,12H,1H3,(H,13,14).
What are the key properties of 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid?
2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid has a molecular weight of 239.25 g/mol, XLogP of 1.67, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(5-methylsulfanyl-1,3-benzoxazol-2-yl)acetic acid is sourced from PubChem (CID 131409068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).