C23H24N2O — CID 13140970
7,7-dimethyl-1-(3-methylphenyl)-2-phenyl-6,8-dihydro-5H-pyrrolo[3,2-c]azepin-4-one (PubChem CID 13140970) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is 7,7-dimethyl-1-(3-methylphenyl)-2-phenyl-6,8-dihydro-5H-pyrrolo[3,2-c]azepin-4-one.
| Compound Name | 7,7-dimethyl-1-(3-methylphenyl)-2-phenyl-6,8-dihydro-5H-pyrrolo[3,2-c]azepin-4-one |
|---|---|
| PubChem CID | 13140970 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 7,7-dimethyl-1-(3-methylphenyl)-2-phenyl-6,8-dihydro-5H-pyrrolo[3,2-c]azepin-4-one |
| SMILES | Cc1cccc(-n2c(-c3ccccc3)cc3c2CC(C)(C)CNC3=O)c1 |
| InChI | InChI=1S/C23H24N2O/c1-16-8-7-11-18(12-16)25-20(17-9-5-4-6-10-17)13-19-21(25)14-23(2,3)15-24-22(19)26/h4-13H,14-15H2,1-3H3,(H,24,26) |
| InChIKey | YNSZERSTPVRWHW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|