C25H26N2O4 — CID 6524308
ethyl 2-hydroxy-5-[(4Z)-4-hydroxyimino-6,6-dimethyl-2-phenyl-5,7-dihydroindol-1-yl]benzoate (PubChem CID 6524308) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is ethyl 2-hydroxy-5-[(4Z)-4-hydroxyimino-6,6-dimethyl-2-phenyl-5,7-dihydroindol-1-yl]benzoate.
| Compound Name | ethyl 2-hydroxy-5-[(4Z)-4-hydroxyimino-6,6-dimethyl-2-phenyl-5,7-dihydroindol-1-yl]benzoate |
|---|---|
| PubChem CID | 6524308 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | ethyl 2-hydroxy-5-[(4Z)-4-hydroxyimino-6,6-dimethyl-2-phenyl-5,7-dihydroindol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cc(-n2c(-c3ccccc3)cc3c2CC(C)(C)C/C3=N/O)ccc1O |
| InChI | InChI=1S/C25H26N2O4/c1-4-31-24(29)19-12-17(10-11-23(19)28)27-21(16-8-6-5-7-9-16)13-18-20(26-30)14-25(2,3)15-22(18)27/h5-13,28,30H,4,14-15H2,1-3H3/b26-20- |
| InChIKey | AERHYXPCJFPYBL-QOMWVZHYSA-N |
| XLogP | 5.18 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|