C28H27NO3 — CID 66685938
ethyl 3-[4-(2-methyl-3,5-diphenylpyrrol-1-yl)phenoxy]propanoate (PubChem CID 66685938) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is ethyl 3-[4-(2-methyl-3,5-diphenylpyrrol-1-yl)phenoxy]propanoate.
| Compound Name | ethyl 3-[4-(2-methyl-3,5-diphenylpyrrol-1-yl)phenoxy]propanoate |
|---|---|
| PubChem CID | 66685938 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | ethyl 3-[4-(2-methyl-3,5-diphenylpyrrol-1-yl)phenoxy]propanoate |
| SMILES | CCOC(=O)CCOc1ccc(-n2c(-c3ccccc3)cc(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C28H27NO3/c1-3-31-28(30)18-19-32-25-16-14-24(15-17-25)29-21(2)26(22-10-6-4-7-11-22)20-27(29)23-12-8-5-9-13-23/h4-17,20H,3,18-19H2,1-2H3 |
| InChIKey | BXAJJKJWTKOIGE-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|